Compound Q&A

What are the main uses of 4-Chloro-3-nitrobenzoic acid (CAS: 96-99-1)?

Answer

4-Chloro-3-nitrobenzoic acid
4-Chloro-3-nitrobenzoic acid (CAS: 96-99-1) is widely used in pharmaceutical research as a building block for drug development. It also finds applications in the synthesis of dyes, pigments, and agrochemicals. In industrial settings, it is used as an intermediate in the production of various organic compounds. Additionally, it is employed in research for studying chemical reactions and material properties.

About

CAS No 96-99-1
English Name 4-Chloro-3-nitrobenzoic acid
Molecular Formula C7H4ClNO4
Molecular Weight 201.56 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])Cl
InChIKey DFXQXFGFOLXAPO-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 4-Chloro-3-nitrobenzoic acid (CAS: 96-99-1)?

4-Chloro-3-nitrobenzoic acid (CAS: 96-99-1) is an organic compound with the chemical formula C7H5ClN...

Compound Q&A

Is 4-Chloro-3-nitrobenzoic acid (CAS: 96-99-1) safe?

4-Chloro-3-nitrobenzoic acid (CAS: 96-99-1) is considered hazardous due to its potential to cause sk...

Compound Q&A

How should 4-Chloro-3-nitrobenzoic acid (CAS: 96-99-1) be stored?

4-Chloro-3-nitrobenzoic acid (CAS: 96-99-1) should be stored in a tightly sealed container in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...