Compound Q&A

What is {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine (1:1) (CAS: 78213-16-8)?

Answer

{2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine (1:1)
This compound, with the CAS number 78213-16-8, is a combination of {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid and N-ethylethanamine in a 1:1 ratio. It has the molecular formula C15H16Cl2N2O2 and is typically a crystalline solid. The compound exhibits moderate solubility in organic solvents and is known for its chemical stability under standard conditions. Its structure includes a dichlorophenyl group, an amino linkage, and acetic acid functionality, making it relevant in pharmaceutical and chemical research.

About

CAS No 78213-16-8
English Name {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine (1:1)
Molecular Formula C18H22Cl2N2O2
Molecular Weight 369.29 g/mol
SMILES CCNCC.C1=CC=C(C(=C1)CC(=O)O)NC2=C(C=CC=C2Cl)Cl
InChIKey ZQVZPANTCLRASL-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine (1:1) (CAS: 78213-16-8)?

The compound {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine (1:1) (CAS: 78213-...

Compound Q&A

Is {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine (1:1) (CAS: 78213-16-8) safe?

Safety of {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine (1:1) (CAS: 78213-16-...

Compound Q&A

How should {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine (1:1) (CAS: 78213-16-8) be stored?

To ensure stability and safety, {2-[(2,6-Dichlorophenyl)amino]phenyl}acetic acid - N-ethylethanamine...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...