Compound Q&A

What are the main uses of Palladium(2+) diacetate (CAS: 3375-31-3)?

Answer

Palladium(2+) diacetate
Palladium(2+) diacetate (CAS: 3375-31-3) is widely used in pharmaceuticals for catalyzing cross-coupling reactions, such as the Suzuki reaction, to synthesize complex molecules. In industry, it serves as a catalyst in hydrogenation and oxidation processes. It is also employed in research for organic chemistry applications and in materials science for creating functional compounds.

About

CAS No 3375-31-3
English Name Palladium(2+) diacetate
Molecular Formula C4H6O4Pd
Molecular Weight 166.47 g/mol
SMILES CC(=O)[O-].CC(=O)[O-].[Pd+2]
InChIKey YJVFFLUZDVXJQI-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Palladium(2+) diacetate (CAS: 3375-31-3)?

Palladium(2+) diacetate (CAS: 3375-31-3) is a coordination compound with the chemical formula Pd(OAc...

Compound Q&A

Is Palladium(2+) diacetate (CAS: 3375-31-3) safe?

Palladium(2+) diacetate (CAS: 3375-31-3) is generally considered low in toxicity compared to other p...

Compound Q&A

How should Palladium(2+) diacetate (CAS: 3375-31-3) be stored?

Palladium(2+) diacetate (CAS: 3375-31-3) should be stored in a sealed, airtight container in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...