Compound Q&A

What are the main uses of ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate (CAS: 27143-07-3)?

Answer

ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate
Ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate is primarily used in pharmaceutical research for the synthesis of drugs and bioactive compounds. It also finds applications in organic chemistry as a reagent for forming hydrazones and in the development of agrochemicals. Due to its structural versatility, it is valuable in various research fields including medicinal chemistry and chemical synthesis.

About

CAS No 27143-07-3
English Name ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate
Molecular Formula C11H13ClN2O3
Molecular Weight 256.69 g/mol
SMILES CCOC(=O)/C(=N/Nc1ccc(cc1)OC)/Cl
InChIKey ATNPZEGMKLGIFA-UVTDQMKNSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate (CAS: 27143-07-3)?

Ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate is an organic compound with the CAS number 2714...

Compound Q&A

Is ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate (CAS: 27143-07-3) safe?

Ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate should be handled with care due to its potentia...

Compound Q&A

How should ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate (CAS: 27143-07-3) be stored?

Ethyl 2-chloro-2-[(4-methoxyphenyl)hydrazono]acetate should be stored in a cool, dry, and well-venti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...