Compound Q&A

What is Tetraphenylporphyrin (CAS: 917-23-7)?

Answer

Tetraphenylporphyrin
Tetraphenylporphyrin is a synthetic organic compound with the chemical formula C32H24N4. It is a type of porphyrin, characterized by a large ring structure with four phenyl groups attached. This compound is known for its strong absorption of light in the visible spectrum and is often used as a photosensitizer in various scientific applications. Its stability and unique photophysical properties make it valuable in chemical research and industrial processes.

About

CAS No 917-23-7
English Name Tetraphenylporphyrin
Molecular Formula C44H28N4
Molecular Weight 614.75 g/mol
SMILES C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C=C4)C9=CC=CC=C9)N3
InChIKey ASQZPNGAQXZRMQ-SDBBQPGRSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Tetraphenylporphyrin (CAS: 917-23-7)?

Tetraphenylporphyrin is primarily used in photodynamic therapy for medical applications, as a cataly...

Compound Q&A

Is Tetraphenylporphyrin (CAS: 917-23-7) safe?

Tetraphenylporphyrin is generally considered safe when handled properly, but it may cause irritation...

Compound Q&A

How should Tetraphenylporphyrin (CAS: 917-23-7) be stored?

Tetraphenylporphyrin should be stored in a cool, dry, and dark place to maintain its stability and p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...