Compound Q&A

What are the main uses of (2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol (CAS: 19130-96-2)?

Answer

(2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol
This compound is widely utilized in pharmaceutical research for the development of drugs and as a building block in complex molecule synthesis. It also finds applications in industrial chemistry for creating polymers and functional materials. Additionally, it is employed in research settings for studying chemical reactions and molecular interactions.

About

CAS No 19130-96-2
English Name (2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol
Molecular Formula C6H13NO4
Molecular Weight 163.17 g/mol
SMILES OC[C@H]1NC[C@H](O)[C@@H](O)[C@@H]1O
InChIKey LXBIFEVIBLOUGU-JGWLITMVSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol (CAS: 19130-96-2)?

(2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol (CAS: 19130-96-2) is a multifunctional organi...

Compound Q&A

Is (2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol (CAS: 19130-96-2) safe?

(2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol (CAS: 19130-96-2) is generally considered saf...

Compound Q&A

How should (2R,3R,4R,5S)-2-(Hydroxymethyl)-3,4,5-piperidinetriol (CAS: 19130-96-2) be stored?

This compound should be stored in a cool, dry, and dark place to maintain stability. It is best kept...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...