Compound Q&A

What is [2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone (CAS: 1843-05-6)?

Answer

[2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone
[2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone (CAS: 1843-05-6) is an organic compound belonging to the class of ketones. It contains a benzene ring substituted with hydroxy and octyloxy groups, and a ketone functional group. This compound is known for its stability and is commonly used in various chemical applications due to its versatile structure.

About

CAS No 1843-05-6
English Name [2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone
Molecular Formula C21H26O3
Molecular Weight 326.43600000000004 g/mol
SMILES CCCCCCCCOc1ccc(c(c1)O)C(=O)c1ccccc1
InChIKey QUAMTGJKVDWJEQ-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of [2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone (CAS: 1843-05-6)?

[2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone (CAS: 1843-05-6) is widely used in pharmaceuticals a...

Compound Q&A

Is [2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone (CAS: 1843-05-6) safe?

[2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone (CAS: 1843-05-6) is generally considered safe when h...

Compound Q&A

How should [2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone (CAS: 1843-05-6) be stored?

[2-Hydroxy-4-(octyloxy)phenyl](phenyl)methanone (CAS: 1843-05-6) should be stored in a cool, dry, an...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...