Compound Q&A

How should (2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 80822-15-7) be stored?

Answer

(2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1)
(2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) should be stored in a cool, dry place, away from light, in a sealed, airtight container. It is stable under these conditions but may degrade if exposed to moisture or high humidity. Maintain storage at temperatures below 25°C and ensure proper labeling to prevent contamination or accidental use.

About

CAS No 80822-15-7
English Name (2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1)
Molecular Formula C18H16O9
Molecular Weight 376.3170000000001 g/mol
SMILES O=C(O)[C@@H](OC(C1=CC=CC=C1)=O)[C@H](OC(C2=CC=CC=C2)=O)C(O)=O.[H]O[H]
InChIKey DXDIHODZARUBLA-IODNYQNNSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is (2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 80822-15-7)?

(2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) is a chemical compound with the CAS number 8...

Compound Q&A

What are the main uses of (2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 80822-15-7)?

(2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) is primarily used in pharmaceuticals as a pr...

Compound Q&A

Is (2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) (CAS: 80822-15-7) safe?

(2S,3S)-2,3-Bis(benzoyloxy)succinic acid hydrate (1:1) is generally considered safe when handled pr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...