Compound Q&A

Is Ceftriaxone sodium salt (CAS: 74578-69-1) safe?

Answer

Ceftriaxone sodium salt
Ceftriaxone sodium salt (CAS: 74578-69-1) is generally considered safe when used as directed in medical and research settings. However, like all antibiotics, it can cause side effects such as allergic reactions, gastrointestinal issues, or changes in liver function. Proper handling, including wearing gloves and protective eyewear, is recommended to ensure safety during preparation and administration.

About

CAS No 74578-69-1
English Name Ceftriaxone sodium salt
Molecular Formula C18H17N8NaO7S3
Molecular Weight 576.56 g/mol
SMILES CO/N=C(\c1csc(n1)N)/C(=O)N[C@@H]1C(=O)N2[C@@H]1SCC(=C2C(=O)[O-])CSc1nc(=O)c(=O)[nH]n1C.[Na+]
InChIKey FDRNWTJTHBSPMW-BBJOQENWSA-L
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Ceftriaxone sodium salt (CAS: 74578-69-1)?

Ceftriaxone sodium salt (CAS: 74578-69-1) is a broad-spectrum antibiotic belonging to the cephalospo...

Compound Q&A

What are the main uses of Ceftriaxone sodium salt (CAS: 74578-69-1)?

Ceftriaxone sodium salt (CAS: 74578-69-1) is primarily used as an antibiotic to treat various bacter...

Compound Q&A

How should Ceftriaxone sodium salt (CAS: 74578-69-1) be stored?

Ceftriaxone sodium salt (CAS: 74578-69-1) should be stored in a cool, dry place away from direct lig...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...