Compound Q&A

What is [Nitrilotris(methylene)]tris(phosphonic acid) (CAS: 6419-19-8)?

Answer

[Nitrilotris(methylene)]tris(phosphonic acid)
[Nitrilotris(methylene)]tris(phosphonic acid), with CAS number 6419-19-8, is a multifunctional organic phosphonic acid compound. It has the chemical formula C6H18N3O12P3 and is characterized by its three phosphonic acid groups attached to a nitrilotris(methylene) backbone. This compound is known for its high stability and chelating properties, making it useful in various industrial and chemical applications.

About

CAS No 6419-19-8
English Name [Nitrilotris(methylene)]tris(phosphonic acid)
Molecular Formula C3H12NO9P3
Molecular Weight 299.05 g/mol
SMILES OP(CN(CP(O)(O)=O)CP(O)(O)=O)(O)=O
InChIKey YDONNITUKPKTIG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of [Nitrilotris(methylene)]tris(phosphonic acid) (CAS: 6419-19-8)?

[Nitrilotris(methylene)]tris(phosphonic acid) is widely used in pharmaceuticals as a chelating agent...

Compound Q&A

Is [Nitrilotris(methylene)]tris(phosphonic acid) (CAS: 6419-19-8) safe?

[Nitrilotris(methylene)]tris(phosphonic acid) is generally considered safe when handled properly, bu...

Compound Q&A

How should [Nitrilotris(methylene)]tris(phosphonic acid) (CAS: 6419-19-8) be stored?

[Nitrilotris(methylene)]tris(phosphonic acid) should be stored in a cool, dry, and well-ventilated a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...