Compound Q&A

What is 2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 556-67-2)?

Answer

2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane
2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 556-67-2) is a synthetic organosilicon compound characterized by its complex structure of eight methyl groups and four oxygen atoms attached to a silicon-based backbone. It is a white solid with low solubility in water and is commonly used as a chemical intermediate in research and industrial applications.

About

CAS No 556-67-2
English Name 2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane
Molecular Formula C8H24O4Si4
Molecular Weight 296.62 g/mol
SMILES C[Si]1(C)O[Si](C)(C)O[Si](O[Si](O1)(C)C)(C)C
InChIKey HMMGMWAXVFQUOA-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 556-67-2)?

This compound is primarily used in the synthesis of other silicon-containing materials, such as sili...

Compound Q&A

Is 2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 556-67-2) safe?

2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 556-67-2) is generally conside...

Compound Q&A

How should 2,2,4,4,6,6,8,8-Octamethyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane (CAS: 556-67-2) be stored?

This compound should be stored in a cool, dry, and dark place, away from moisture and direct sunligh...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...