Compound Q&A

What is Phosphocreatine sodium (CAS: 922-32-7)?

Answer

Phosphocreatine sodium
Phosphocreatine sodium is a sodium salt of phosphocreatine, a high-energy phosphate compound that plays a key role in energy storage and transfer in biological systems. It has the chemical formula C5H12NO12P3Na and is commonly used in biochemical research and medical applications. Phosphocreatine sodium is known for its ability to donate phosphate groups to ADP to regenerate ATP, making it essential in cellular energy metabolism.

About

CAS No 922-32-7
English Name Phosphocreatine sodium
Molecular Formula C4H17N3Na3O10P
Molecular Weight 367.14 g/mol
SMILES CN(CC(=O)O)C(=NP(=O)([O-])[O-])N.[Na+].[Na+]
InChIKey FFKYYXNXZDLJDX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Phosphocreatine sodium (CAS: 922-32-7)?

Phosphocreatine sodium is primarily used in pharmaceutical and research settings to study energy met...

Compound Q&A

Is Phosphocreatine sodium (CAS: 922-32-7) safe?

Phosphocreatine sodium is generally considered safe when handled properly and used within recommende...

Compound Q&A

How should Phosphocreatine sodium (CAS: 922-32-7) be stored?

Phosphocreatine sodium should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is sens...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...