Compound Q&A

What is Dimethyl phthalate (CAS: 131-11-3)?

Answer

Dimethyl phthalate
Dimethyl phthalate is an organic compound with the chemical formula C10H10O4. It is a colorless liquid with a faint ester-like odor, commonly used as a plasticizer and solvent. This compound is known for its low volatility and good solubility in organic solvents, making it versatile in various chemical applications.

About

CAS No 131-11-3
English Name Dimethyl phthalate
Molecular Formula C10H10O4
Molecular Weight 194.18599999999995 g/mol
SMILES COC(=O)C1=CC=CC=C1C(=O)OC
InChIKey NIQCNGHVCWTJSM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Dimethyl phthalate (CAS: 131-11-3)?

Dimethyl phthalate is widely used in the pharmaceutical industry as a solvent and stabilizer. It als...

Compound Q&A

Is Dimethyl phthalate (CAS: 131-11-3) safe?

Dimethyl phthalate is generally considered safe when used in accordance with proper handling guideli...

Compound Q&A

How should Dimethyl phthalate (CAS: 131-11-3) be stored?

Dimethyl phthalate should be stored in a cool, dry, and well-ventilated area, away from direct sunli...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...