Compound Q&A

What is Ligustilide (CAS: 4431-01-0)?

Answer

Ligustilide is a natural compound found in the roots of certain plants, such as Angelica sinensis. It has the chemical formula C14H14O2 and is known for its unique aromatic properties and potential therapeutic applications. Ligustilide is commonly used in traditional medicine and is also a subject of interest in modern pharmacological research due to its bioactive characteristics.

About

CAS No 4431-01-0

English Name Ligustilide

Molecular Formula C12H14O2

Molecular Weight 190.24199999999993 g/mol

SMILES CCCC=C1C2=C(C=CCC2)C(=O)O1

InChIKey IQVQXVFMNOFTMU-FLIBITNWSA-N

Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Ligustilide (CAS: 4431-01-0)?

Ligustilide is primarily used in pharmaceuticals for its potential anti-inflammatory, antioxidant, a...

Compound Q&A

Is Ligustilide (CAS: 4431-01-0) safe?

Ligustilide is generally considered safe when used in appropriate amounts and under proper handling ...

Compound Q&A

How should Ligustilide (CAS: 4431-01-0) be stored?

Ligustilide should be stored in a cool, dry, and dark place to maintain its stability and potency. I...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is Ligustilide (CAS: 4431-01-0)?

Answer

About

Related Q&A

What are the main uses of Ligustilide (CAS: 4431-01-0)?

Is Ligustilide (CAS: 4431-01-0) safe?

How should Ligustilide (CAS: 4431-01-0) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Shenzhen Digestive Well Biological Technology Co., Ltd.

ChengDouKeLuoMa Biotechnology Co Ltd

NaJingDiErGeYiYao Technology Co Ltd

Ningxia Hengrui Kang Biotechnology Co., Ltd.

XiAnZhenLu Biotechnology Co Ltd

NaJingTongZeNongYe Technology Co Ltd