Compound Q&A

What is Ligustilide (CAS: 4431-01-0)?

Answer

Ligustilide
Ligustilide is a natural compound found in the roots of certain plants, such as Angelica sinensis. It has the chemical formula C14H14O2 and is known for its unique aromatic properties and potential therapeutic applications. Ligustilide is commonly used in traditional medicine and is also a subject of interest in modern pharmacological research due to its bioactive characteristics.

About

CAS No 4431-01-0
English Name Ligustilide
Molecular Formula C12H14O2
Molecular Weight 190.24 g/mol
SMILES CCCC=C1C2=C(C=CCC2)C(=O)O1
InChIKey IQVQXVFMNOFTMU-FLIBITNWSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Ligustilide (CAS: 4431-01-0)?

Ligustilide is primarily used in pharmaceuticals for its potential anti-inflammatory, antioxidant, a...

Compound Q&A

Is Ligustilide (CAS: 4431-01-0) safe?

Ligustilide is generally considered safe when used in appropriate amounts and under proper handling ...

Compound Q&A

How should Ligustilide (CAS: 4431-01-0) be stored?

Ligustilide should be stored in a cool, dry, and dark place to maintain its stability and potency. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...