Compound Q&A

What are the main uses of 5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS: 881674-56-2)?

Answer

5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde
This compound is primarily utilized in pharmaceutical research for the synthesis of bioactive molecules and drug candidates. It also finds applications in industrial chemistry as a building block for functional materials and in organic synthesis to create derivatives with tailored properties. Its unique structure makes it valuable in developing compounds for medicinal and specialty chemical purposes.

About

English Name 5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde
Molecular Formula C11H8FNO
Molecular Weight 189.19 g/mol
SMILES c1ccc(c(c1)c2cc(c[nH]2)C=O)F
InChIKey MQULPEUCGKEHEG-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is 5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS: 881674-56-2)?

5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS: 881674-56-2) is a pyrrole derivative with a 2-flu...

Compound Q&A

Is 5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS: 881674-56-2) safe?

Safety of 5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS: 881674-56-2) depends on exposure condit...

Compound Q&A

How should 5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS: 881674-56-2) be stored?

Store 5-(2-Fluorophenyl)-1H-pyrrole-3-carbaldehyde (CAS: 881674-56-2) in a cool, dry, and dark place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...