Compound Q&A

What is 3-Hydroxyestra-1(10),2,4-trien-17-one (CAS: 53-16-7)?

Answer

3-Hydroxyestra-1(10),2,4-trien-17-one
3-Hydroxyestra-1(10),2,4-trien-17-one (CAS: 53-16-7) is a steroid compound that serves as a key intermediate in the synthesis of various pharmaceuticals and biological agents. It has the chemical formula C18H26O3 and is characterized by its hydroxyl and ketone functional groups. This compound is known for its structural similarity to estrogen and plays a role in hormonal research and drug development.

About

CAS No 53-16-7
English Name 3-Hydroxyestra-1(10),2,4-trien-17-one
Molecular Formula C18H22O2
Molecular Weight 270.37 g/mol
SMILES C[C@@]12CC[C@H]3[C@@H](CCc4cc(O)ccc34)[C@@H]2CCC1=O
InChIKey DNXHEGUUPJUMQT-CBZIJGRNSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 3-Hydroxyestra-1(10),2,4-trien-17-one (CAS: 53-16-7)?

3-Hydroxyestra-1(10),2,4-trien-17-one (CAS: 53-16-7) is primarily used in pharmaceutical research fo...

Compound Q&A

Is 3-Hydroxyestra-1(10),2,4-trien-17-one (CAS: 53-16-7) safe?

The safety of 3-Hydroxyestra-1(10),2,4-trien-17-one (CAS: 53-16-7) depends on its handling and appli...

Compound Q&A

How should 3-Hydroxyestra-1(10),2,4-trien-17-one (CAS: 53-16-7) be stored?

3-Hydroxyestra-1(10),2,4-trien-17-one (CAS: 53-16-7) should be stored in a cool, dry, and dark place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...