Compound Q&A

What are the main uses of Evodiamine (CAS: 518-17-2)?

Answer

Evodiamine
Evodiamine is primarily used in pharmaceutical research for its potential therapeutic applications, such as treating inflammation, pain, and cancer. It also finds use in the food industry as a flavoring agent and in traditional medicine for digestive and respiratory support. Additionally, it is studied for its role in drug development and as a research tool in biochemistry and pharmacology.

About

CAS No 518-17-2
English Name Evodiamine
Molecular Formula C19H17N3O
Molecular Weight 303.4 g/mol
SMILES CN1C2C3=C(CCN2C(=O)C4=CC=CC=C41)C5=CC=CC=C5N3
InChIKey TXDUTHBFYKGSAH-SFHVURJKSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What is Evodiamine (CAS: 518-17-2)?

Evodiamine is a naturally occurring alkaloid derived from the dried fruit of the Evodia rutaecarpa p...

Compound Q&A

Is Evodiamine (CAS: 518-17-2) safe?

Evodiamine is generally considered safe when used in appropriate amounts and under controlled condit...

Compound Q&A

How should Evodiamine (CAS: 518-17-2) be stored?

Evodiamine should be stored in a cool, dry, and dark place, ideally at temperatures below 25°C. It i...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...