Compound Q&A

What is 1-(2-Chloro-4-pyridinyl)-3-phenylurea (CAS: 68157-60-8)?

Answer

1-(2-Chloro-4-pyridinyl)-3-phenylurea
1-(2-Chloro-4-pyridinyl)-3-phenylurea is an organic compound with the CAS number 68157-60-8. It has the chemical formula C12H10ClN3O and is characterized by its urea functional group connected to a pyridine ring and a phenyl group. This compound is known for its stability and solubility in polar solvents, making it suitable for various chemical applications.

About

CAS No 68157-60-8
English Name 1-(2-Chloro-4-pyridinyl)-3-phenylurea
Molecular Formula C12H10ClN3O
Molecular Weight 247.69 g/mol
SMILES O=C(Nc1ccnc(c1)Cl)Nc1ccccc1
InChIKey GPXLRLUVLMHHIK-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1-(2-Chloro-4-pyridinyl)-3-phenylurea (CAS: 68157-60-8)?

1-(2-Chloro-4-pyridinyl)-3-phenylurea is primarily used in pharmaceutical research as an intermediat...

Compound Q&A

Is 1-(2-Chloro-4-pyridinyl)-3-phenylurea (CAS: 68157-60-8) safe?

1-(2-Chloro-4-pyridinyl)-3-phenylurea is generally considered safe when handled properly. However, i...

Compound Q&A

How should 1-(2-Chloro-4-pyridinyl)-3-phenylurea (CAS: 68157-60-8) be stored?

1-(2-Chloro-4-pyridinyl)-3-phenylurea should be stored in a cool, dry, and dark place, away from moi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...