Compound Q&A

What is Bergenin (CAS: 477-90-7)?

Answer

Bergenin
Bergenin, with the CAS number 477-90-7, is a naturally occurring iridoid glycoside primarily found in the roots of the plant *Bergenia cordifolia*. It has a molecular formula of C15H18O9 and is known for its bitter taste and various biological activities, including anti-inflammatory and antimicrobial properties.

About

CAS No 477-90-7
English Name Bergenin
Molecular Formula C14H16O9
Molecular Weight 328.27 g/mol
SMILES COc1c(O)cc2C(=O)O[C@@H]3[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]3c2c1O
InChIKey YWJXCIXBAKGUKZ-HJJNZUOJSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of Bergenin (CAS: 477-90-7)?

Bergenin is used in pharmaceutical and nutraceutical industries for its potential therapeutic applic...

Compound Q&A

Is Bergenin (CAS: 477-90-7) safe?

Bergenin is generally considered safe when used in appropriate amounts and under proper handling con...

Compound Q&A

How should Bergenin (CAS: 477-90-7) be stored?

Bergenin should be stored in a cool, dry, and dark place to maintain its stability and potency. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...