Compound Q&A

What is 1,2-Dimethyl-5-nitro-1H-imidazole (CAS: 551-92-8)?

Answer

1,2-Dimethyl-5-nitro-1H-imidazole
1,2-Dimethyl-5-nitro-1H-imidazole (CAS: 551-92-8) is a heterocyclic organic compound containing an imidazole ring with methyl groups at positions 1 and 2, and a nitro group at position 5. It is known for its potential applications in chemical synthesis and pharmaceutical research.

About

CAS No 551-92-8
English Name 1,2-Dimethyl-5-nitro-1H-imidazole
Molecular Formula C5H7N3O2
Molecular Weight 141.13 g/mol
SMILES CN1C(C)=NC=C1[N+]([O-])=O
InChIKey IBXPYPUJPLLOIN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:08

Related Q&A

Compound Q&A

What are the main uses of 1,2-Dimethyl-5-nitro-1H-imidazole (CAS: 551-92-8)?

1,2-Dimethyl-5-nitro-1H-imidazole (CAS: 551-92-8) is primarily used in the synthesis of pharmaceutic...

Compound Q&A

Is 1,2-Dimethyl-5-nitro-1H-imidazole (CAS: 551-92-8) safe?

1,2-Dimethyl-5-nitro-1H-imidazole (CAS: 551-92-8) should be handled with care as it may have toxic p...

Compound Q&A

How should 1,2-Dimethyl-5-nitro-1H-imidazole (CAS: 551-92-8) be stored?

1,2-Dimethyl-5-nitro-1H-imidazole (CAS: 551-92-8) should be stored in a cool, dry, and well-ventilat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...