Compound Q&A

What is Tetracaine (CAS: 94-24-6)?

Answer

Tetracaine is a local anesthetic with the chemical formula C15H18N2O2. It is a yellowish crystalline powder that is soluble in water and alcohol. Tetracaine is known for its potency and long duration of action, making it useful in various medical applications. It belongs to the class of amide-type anesthetics and is commonly used in ophthalmology and dentistry.

About

CAS No 94-24-6

English Name Tetracaine

Molecular Formula C15H24N2O2

Molecular Weight 264.36899999999997 g/mol

SMILES CCCCNC1=CC=C(C=C1)C(=O)OCCN(C)C

InChIKey GKCBAIGFKIBETG-UHFFFAOYSA-N

Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Tetracaine (CAS: 94-24-6)?

Tetracaine is primarily used as a topical anesthetic in pharmaceuticals, especially in eye drops and...

Compound Q&A

Is Tetracaine (CAS: 94-24-6) safe?

Tetracaine is generally considered safe when used as directed, but it can cause toxicity if absorbed...

Compound Q&A

How should Tetracaine (CAS: 94-24-6) be stored?

Tetracaine should be stored in a tightly sealed container, away from light and moisture. It is typic...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What is Tetracaine (CAS: 94-24-6)?

Answer

About

Related Q&A

What are the main uses of Tetracaine (CAS: 94-24-6)?

Is Tetracaine (CAS: 94-24-6) safe?

How should Tetracaine (CAS: 94-24-6) be stored?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Qingdao Xinuo Medicine Chemistry Co., Ltd.

HangZhouXinWeiYiYao Chemical Co Ltd

HuBeiXinGongLi Chemical Co Ltd

Shanghai Titan Shareholding Technology Co., Ltd.

HuBeiXinKangYiYao Chemical Co Ltd

SiChuanWeiKeJi Biotechnology Co Ltd