Compound Q&A

What is Tocopheryl acetate (CAS: 7695-91-2)?

Answer

Tocopheryl acetate
Tocopheryl acetate is a derivative of vitamin E, commonly used as an antioxidant. Its chemical formula is C20H36O2. It is a pale yellow to yellowish oily liquid with a molecular weight of 308.51 g/mol. Tocopheryl acetate is known for its stability and ability to protect fats and oils from oxidation, making it a popular ingredient in various industries.

About

CAS No 7695-91-2
English Name Tocopheryl acetate
Molecular Formula C31H52O3
Molecular Weight 472.74 g/mol
SMILES CC(CCCC1(C)CCc2c(O1)c(C)c(c(c2C)OC(=O)C)C)CCCC(CCCC(C)C)C
InChIKey ZAKOWWREFLAJOT-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Tocopheryl acetate (CAS: 7695-91-2)?

Tocopheryl acetate is widely used in pharmaceuticals as a vitamin E supplement and antioxidant. It a...

Compound Q&A

Is Tocopheryl acetate (CAS: 7695-91-2) safe?

Tocopheryl acetate is generally considered safe when used in appropriate amounts. It has low toxicit...

Compound Q&A

How should Tocopheryl acetate (CAS: 7695-91-2) be stored?

Tocopheryl acetate should be stored in a cool, dry, and dark place to maintain its stability and eff...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...