Compound Q&A

What is (3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid (CAS: 83-44-3)?

Answer

(3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid
(3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid, with the CAS number 83-44-3, is a bile acid derivative. It has the chemical formula C24H42O5 and is known for its hydrophilic properties. This compound is commonly used in scientific research and pharmaceutical applications due to its structural similarity to natural bile acids such as cholic acid.

About

CAS No 83-44-3
English Name (3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid
Molecular Formula C24H40O4
Molecular Weight 392.58 g/mol
SMILES C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C
InChIKey KXGVEGMKQFWNSR-LLQZFEROSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid (CAS: 83-44-3)?

(3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid (CAS: 83-44-3) is primarily used in pharmace...

Compound Q&A

Is (3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid (CAS: 83-44-3) safe?

The safety of (3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid (CAS: 83-44-3) largely depends...

Compound Q&A

How should (3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid (CAS: 83-44-3) be stored?

(3alpha,5beta,12alpha)-3,12-Dihydroxycholan-24-oic acid (CAS: 83-44-3) should be stored in a cool, d...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...