Compound Q&A

What are the main uses of Arbidol HCl (CAS: 131707-23-8)?

Answer

Arbidol HCl
Arbidol HCl is mainly used in pharmaceutical applications for its antiviral properties. It is prescribed to treat respiratory tract infections, including influenza and viral pneumonia. Additionally, it is used as a prophylactic agent to prevent viral infections. In research settings, it is studied for its potential in combating other viral pathogens and enhancing immune responses.

About

English Name Arbidol HCl
Molecular Formula C22H26BrClN2O3S
Molecular Weight 513.9 g/mol
SMILES CCOC(=O)C1=C(N(C2=CC(=C(C(=C21)CN(C)C)O)Br)C)CSC3=CC=CC=C3.Cl
InChIKey OMZHXQXQJGCSKN-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Arbidol HCl (CAS: 131707-23-8)?

Arbidol HCl, also known as umifenovir hydrochloride (CAS: 131707-23-8), is a pharmaceutical compound...

Compound Q&A

Is Arbidol HCl (CAS: 131707-23-8) safe?

Arbidol HCl is generally considered safe when used as directed, but it should be handled with approp...

Compound Q&A

How should Arbidol HCl (CAS: 131707-23-8) be stored?

Arbidol HCl should be stored in a cool, dry, and dark place, away from moisture and direct sunlight....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...