Compound Q&A

What is (2S)-1-(2-{[(1R,5S,7S)-3-hydroxyadamantan-1-yl]amino}acetyl)pyrrolidine-2-carbonitrile (CAS: 274901-16-5)?

Answer

(2S)-1-(2-{[(1R,5S,7S)-3-hydroxyadamantan-1-yl]amino}acetyl)pyrrolidine-2-carbonitrile
The compound (2S)-1-(2-{[(1R,5S,7S)-3-hydroxyadamantan-1-yl]amino}acetyl)pyrrolidine-2-carbonitrile, with CAS number 274901-16-5, is a synthetic organic compound characterized by a pyrrolidine ring linked to a nitrile group and an amino acid side chain. It exhibits structural complexity due to the presence of multiple stereocenters and is often used in pharmaceutical research as a potential drug candidate.

About

English Name (2S)-1-(2-{[(1R,5S,7S)-3-hydroxyadamantan-1-yl]amino}acetyl)pyrrolidine-2-carbonitrile
Molecular Formula C17H25N3O2
Molecular Weight 292.42 g/mol
SMILES C1CC(N(C1)C(=O)CNC23CC4CC(C2)CC(C4)(C3)O)C#N
InChIKey WOWDLLLNIGXFFA-UXCWVVDGSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (2S)-1-(2-{[(1R,5S,7S)-3-hydroxyadamantan-1-yl]amino}acetyl)pyrrolidine-2-carbonitrile (CAS: 274901-16-5)?

This compound is primarily used in pharmaceutical development for its potential as an inhibitor of s...

Compound Q&A

Is (2S)-1-(2-{[(1R,5S,7S)-3-hydroxyadamantan-1-yl]amino}acetyl)pyrrolidine-2-carbonitrile (CAS: 274901-16-5) safe?

Safety data for this compound is limited, but it is generally considered to have moderate toxicity p...

Compound Q&A

How should (2S)-1-(2-{[(1R,5S,7S)-3-hydroxyadamantan-1-yl]amino}acetyl)pyrrolidine-2-carbonitrile (CAS: 274901-16-5) be stored?

The compound should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is sensitive to m...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...