Compound Q&A

What is (3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid (CAS: 83-49-8)?

Answer

(3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid
(3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid, with CAS number 83-49-8, is a bile acid derivative found in the bile of certain animals. It has the chemical formula C24H44O5 and is characterized by its hydroxyl groups at positions 3, 6, and 24, along with a cholic acid backbone. This compound is known for its role in lipid metabolism and is used in various scientific studies.

About

CAS No 83-49-8
English Name (3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid
Molecular Formula C24H40O4
Molecular Weight 392.58 g/mol
SMILES OC1CC[C@]2(C(C1)CC([C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)O)C)C)O)C
InChIKey DGABKXLVXPYZII-SIBKNCMHSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid (CAS: 83-49-8)?

(3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid (CAS: 83-49-8) is primarily used in pharmaceut...

Compound Q&A

Is (3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid (CAS: 83-49-8) safe?

(3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid (CAS: 83-49-8) is generally considered safe wh...

Compound Q&A

How should (3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid (CAS: 83-49-8) be stored?

(3alpha,5beta,6alpha)-3,6-Dihydroxycholan-24-oic acid (CAS: 83-49-8) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...