Compound Q&A

Is 5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one (CAS: 491-67-8) safe?

Answer

5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one
5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one (CAS: 491-67-8) is generally considered safe when handled properly. However, it may irritate skin, eyes, or respiratory systems upon prolonged exposure. Safety precautions include wearing protective gloves, goggles, and a lab coat. Always follow standard chemical safety protocols, as toxicity data is limited but potential hazards exist due to its chemical structure.

About

CAS No 491-67-8
English Name 5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one
Molecular Formula C15H10O5
Molecular Weight 270.24 g/mol
SMILES Oc1cc2oc(cc(=O)c2c(O)c1O)c3ccccc3
InChIKey FXNFHKRTJBSTCS-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one (CAS: 491-67-8)?

5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one (CAS: 491-67-8) is a chromone derivative with the chemica...

Compound Q&A

What are the main uses of 5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one (CAS: 491-67-8)?

5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one (CAS: 491-67-8) is primarily used in pharmaceuticals as a...

Compound Q&A

How should 5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one (CAS: 491-67-8) be stored?

5,6,7-Trihydroxy-2-phenyl-4H-chromen-4-one (CAS: 491-67-8) should be stored in a sealed, airtight co...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...