Compound Q&A

What are the main uses of Argireline (CAS: 616204-22-9)?

Answer

Argireline
Argireline (CAS: 616204-22-9) is primarily used in skincare and cosmetic formulations to reduce the signs of aging, particularly dynamic wrinkles. It is also applied in pharmaceutical research for its potential muscle-relaxing effects and is used in the development of treatments for conditions involving muscle tension. Additionally, it finds applications in the food industry as a flavor enhancer and in research for studying peptide mechanisms.

About

English Name Argireline
Molecular Formula C34H60N14O12S
Molecular Weight 889 g/mol
SMILES CC(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CCSC)C(=O)NC(CCC(=O)N)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)N
InChIKey RJZNPROJTJSYLC-LLINQDLYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Argireline (CAS: 616204-22-9)?

Argireline, with the CAS number 616204-22-9, is a synthetic peptide known for its muscle relaxant pr...

Compound Q&A

Is Argireline (CAS: 616204-22-9) safe?

Argireline (CAS: 616204-22-9) is generally considered safe when used as directed in cosmetic and pha...

Compound Q&A

How should Argireline (CAS: 616204-22-9) be stored?

Argireline (CAS: 616204-22-9) should be stored in a cool, dry place away from direct light. It is ty...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...