Compound Q&A

What is Betamethasone (CAS: 378-44-9)?

Answer

Betamethasone (Betamethasone Acetate EP Impurity A, Betamethasone Dipropionate EP Impurity A, Betamethasone Valerate EP Impurity A, Dexamethasone EP Impurity B)
Betamethasone, with the CAS number 378-44-9, is a synthetic corticosteroid compound used in pharmaceutical applications. It has the chemical formula C22H29FO6 and is known for its potent anti-inflammatory and immunosuppressive properties. Betamethasone is a glucocorticoid that interacts with glucocorticoid receptors in the body, making it effective for treating various inflammatory and autoimmune conditions.

About

CAS No 378-44-9
English Name Betamethasone (Betamethasone Acetate EP Impurity A, Betamethasone Dipropionate EP Impurity A, Betamethasone Valerate EP Impurity A, Dexamethasone EP Impurity B)
Molecular Formula C22H29FO5
Molecular Weight 392.47 g/mol
SMILES CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)CO)O)C)O)F)C
InChIKey UREBDLICKHMUKA-DVTGEIKXSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Betamethasone (CAS: 378-44-9)?

Betamethasone is primarily used in pharmaceuticals as an anti-inflammatory and immunosuppressive age...

Compound Q&A

Is Betamethasone (CAS: 378-44-9) safe?

Betamethasone is generally considered safe when used as directed, but it requires proper handling du...

Compound Q&A

How should Betamethasone (CAS: 378-44-9) be stored?

Betamethasone should be stored in a cool, dry place away from direct light. It is typically kept at ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...