Compound Q&A

What is (2R,3R)-2-{[(2E)-3-(3,4-Dihydroxyphenyl)-2-propenoyl]oxy}-3-hydroxysuccinic acid (CAS: 67879-58-7)?

Answer

(2R,3R)-2-{[(2E)-3-(3,4-Dihydroxyphenyl)-2-propenoyl]oxy}-3-hydroxysuccinic acid
This compound, with the CAS number 67879-58-7, is a complex organic molecule characterized by its stereochemistry and functional groups. It contains two hydroxyl groups and a conjugated double bond, making it a potential candidate for pharmaceutical applications. Its chemical structure includes a succinic acid backbone with substituted aromatic rings, contributing to its unique chemical properties and biological activity.

About

CAS No 67879-58-7
English Name (2R,3R)-2-{[(2E)-3-(3,4-Dihydroxyphenyl)-2-propenoyl]oxy}-3-hydroxysuccinic acid
Molecular Formula C13H12O9
Molecular Weight 312.23 g/mol
SMILES O=C(O[C@H]([C@H](C(=O)O)O)C(=O)O)/C=C/c1ccc(c(c1)O)O
InChIKey SWGKAHCIOQPKFW-JTNORFRNSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (2R,3R)-2-{[(2E)-3-(3,4-Dihydroxyphenyl)-2-propenoyl]oxy}-3-hydroxysuccinic acid (CAS: 67879-58-7)?

This compound is primarily used in pharmaceutical research for its potential therapeutic properties....

Compound Q&A

Is (2R,3R)-2-{[(2E)-3-(3,4-Dihydroxyphenyl)-2-propenoyl]oxy}-3-hydroxysuccinic acid (CAS: 67879-58-7) safe?

The safety of (2R,3R)-2-{[(2E)-3-(3,4-Dihydroxyphenyl)-2-propenoyl]oxy}-3-hydroxysuccinic acid (CAS:...

Compound Q&A

How should (2R,3R)-2-{[(2E)-3-(3,4-Dihydroxyphenyl)-2-propenoyl]oxy}-3-hydroxysuccinic acid (CAS: 67879-58-7) be stored?

This compound should be stored in a cool, dry, and dark place to maintain its stability. It is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...