Compound Q&A

How should N,N,N-Trioctyl-1-octanaminium bromide (CAS: 14866-33-2) be stored?

Answer

N,N,N-Trioctyl-1-octanaminium bromide
N,N,N-Trioctyl-1-octanaminium bromide (CAS: 14866-33-2) should be stored in a cool, dry place, away from direct light, and in a sealed, airtight container. It is stable under normal storage conditions but should be kept in a well-ventilated area to prevent moisture absorption. Avoid exposure to heat or humidity to maintain its chemical integrity and effectiveness.

About

CAS No 14866-33-2
English Name N,N,N-Trioctyl-1-octanaminium bromide
Molecular Formula C32H68BrN
Molecular Weight 546.8 g/mol
SMILES CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.[Br-]
InChIKey QBVXKDJEZKEASM-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is N,N,N-Trioctyl-1-octanaminium bromide (CAS: 14866-33-2)?

N,N,N-Trioctyl-1-octanaminium bromide (CAS: 14866-33-2) is a quaternary ammonium compound with the c...

Compound Q&A

What are the main uses of N,N,N-Trioctyl-1-octanaminium bromide (CAS: 14866-33-2)?

N,N,N-Trioctyl-1-octanaminium bromide (CAS: 14866-33-2) is primarily used as a surfactant in pharmac...

Compound Q&A

Is N,N,N-Trioctyl-1-octanaminium bromide (CAS: 14866-33-2) safe?

N,N,N-Trioctyl-1-octanaminium bromide (CAS: 14866-33-2) is generally considered safe when handled ac...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...