Compound Q&A

What are the main uses of Tetrabutylphosphonium chloride (CAS: 2304-30-5)?

Answer

Tetrabutylphosphonium chloride
Tetrabutylphosphonium chloride is primarily used in pharmaceuticals for catalyzing reactions in drug synthesis. In industrial settings, it serves as a catalyst in polymerization processes and organic reactions. It also finds applications in research for developing new chemical processes and materials. Additionally, it is employed in electrochemistry as a support material for electrodes and in some cases as a stabilizer for other compounds.

About

CAS No 2304-30-5
English Name Tetrabutylphosphonium chloride
Molecular Formula C16H36ClP
Molecular Weight 294.9 g/mol
SMILES CCCC[P+](CCCC)(CCCC)CCCC.[Cl-]
InChIKey IBWGNZVCJVLSHB-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Tetrabutylphosphonium chloride (CAS: 2304-30-5)?

Tetrabutylphosphonium chloride is a quaternary phosphonium salt with the chemical formula [(CH2)3CH3...

Compound Q&A

Is Tetrabutylphosphonium chloride (CAS: 2304-30-5) safe?

Tetrabutylphosphonium chloride is generally considered low toxicity when handled properly, but it sh...

Compound Q&A

How should Tetrabutylphosphonium chloride (CAS: 2304-30-5) be stored?

Tetrabutylphosphonium chloride should be stored in a cool, dry, and well-ventilated area, away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...