Compound Q&A

What is 2-Bromotriphenylene (CAS: 19111-87-6)?

Answer

2-Bromotriphenylene
2-Bromotriphenylene is an organic compound with the chemical formula C18H14Br2. It is a brominated derivative of triphenylene, a polycyclic aromatic hydrocarbon. This compound is known for its high stability and unique electronic properties, making it useful in various chemical applications. It appears as a yellow solid and is insoluble in water but soluble in organic solvents.

About

CAS No 19111-87-6
English Name 2-Bromotriphenylene
Molecular Formula C18H11Br
Molecular Weight 307.19 g/mol
SMILES C1=CC=C2C(=C1)C3=C(C=C(C=C3)Br)C4=CC=CC=C24
InChIKey GEDOYYDMCZUHNW-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2-Bromotriphenylene (CAS: 19111-87-6)?

2-Bromotriphenylene is primarily used in pharmaceutical research as a building block for drug develo...

Compound Q&A

Is 2-Bromotriphenylene (CAS: 19111-87-6) safe?

2-Bromotriphenylene is generally considered safe when handled properly, but it may pose health risks...

Compound Q&A

How should 2-Bromotriphenylene (CAS: 19111-87-6) be stored?

2-Bromotriphenylene should be stored in a cool, dry, and dark place away from moisture and light. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...