Compound Q&A

What is 2,2,3,4,4,4-Hexafluorobutyl methacrylate (CAS: 36405-47-7)?

Answer

2,2,3,4,4,4-Hexafluorobutyl methacrylate
2,2,3,4,4,4-Hexafluorobutyl methacrylate (CAS: 36405-47-7) is an organic compound with the chemical formula C6H4F6O2. It is a colorless liquid with high fluorine content, which contributes to its exceptional hydrophobic and chemical inert properties. This compound is known for its stability and resistance to solvents, making it suitable for specialized chemical applications.

About

CAS No 36405-47-7
English Name 2,2,3,4,4,4-Hexafluorobutyl methacrylate
Molecular Formula C8H8F6O2
Molecular Weight 250.14 g/mol
SMILES CC(=C)C(=O)OCC(F)(F)C(F)C(F)(F)F
InChIKey DFVPUWGVOPDJTC-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2,2,3,4,4,4-Hexafluorobutyl methacrylate (CAS: 36405-47-7)?

2,2,3,4,4,4-Hexafluorobutyl methacrylate (CAS: 36405-47-7) is widely used in the production of fluor...

Compound Q&A

Is 2,2,3,4,4,4-Hexafluorobutyl methacrylate (CAS: 36405-47-7) safe?

2,2,3,4,4,4-Hexafluorobutyl methacrylate (CAS: 36405-47-7) is generally considered safe when handled...

Compound Q&A

How should 2,2,3,4,4,4-Hexafluorobutyl methacrylate (CAS: 36405-47-7) be stored?

2,2,3,4,4,4-Hexafluorobutyl methacrylate (CAS: 36405-47-7) should be stored in a cool, dry, and well...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...