Compound Q&A

What is 1-Methyl-L-tryptophan (CAS: 21339-55-9)?

Answer

1-Methyl-L-tryptophan
1-Methyl-L-tryptophan is a derivative of the amino acid L-tryptophan, with a methyl group attached to the indole ring. Its chemical formula is C12H14N2O2. It is a white crystalline solid with a slightly bitter taste and is commonly used in chemical research and pharmaceutical development. It is known for its structural similarity to tryptophan and is often studied for its potential biological activities.

About

CAS No 21339-55-9
English Name 1-Methyl-L-tryptophan
Molecular Formula C12H14N2O2
Molecular Weight 218.26 g/mol
SMILES CN1C=C(C2=CC=CC=C21)CC(C(=O)O)N
InChIKey ZADWXFSZEAPBJS-JTQLQIEISA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 1-Methyl-L-tryptophan (CAS: 21339-55-9)?

1-Methyl-L-tryptophan is primarily used in pharmaceutical research as a precursor for various drug c...

Compound Q&A

Is 1-Methyl-L-tryptophan (CAS: 21339-55-9) safe?

1-Methyl-L-tryptophan is generally considered safe when handled properly in controlled environments....

Compound Q&A

How should 1-Methyl-L-tryptophan (CAS: 21339-55-9) be stored?

1-Methyl-L-tryptophan should be stored in a cool, dry, and dark place, ideally at 2-8°C. It is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...