Compound Q&A

What is Tryptophan (CAS: 54-12-6)?

Answer

Tryptophan
Tryptophan is an essential amino acid with the chemical formula C11H12N2O2. It is a colorless crystalline solid that is soluble in water and has a bitter taste. Tryptophan plays a crucial role in protein synthesis and is also known for its involvement in the production of neurotransmitters like serotonin and melatonin. Its CAS number is 54-12-6.

About

CAS No 54-12-6
English Name Tryptophan
Molecular Formula C11H12N2O2
Molecular Weight 204.23 g/mol
SMILES NC(Cc1c[nH]c2ccccc12)C(=O)O
InChIKey QIVBCDIJIAJPQS-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Tryptophan (CAS: 54-12-6)?

Tryptophan is widely used in pharmaceuticals for the treatment of insomnia and depression due to its...

Compound Q&A

Is Tryptophan (CAS: 54-12-6) safe?

Tryptophan is generally considered safe when consumed in recommended amounts. However, high doses ma...

Compound Q&A

How should Tryptophan (CAS: 54-12-6) be stored?

Tryptophan should be stored in a cool, dry, and well-ventilated place, away from direct sunlight. It...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...