Compound Q&A

What is 2-Methyl-5-nitrobenzotrifluoride (CAS: 89976-12-5)?

Answer

2-Methyl-5-nitrobenzotrifluoride
2-Methyl-5-nitrobenzotrifluoride (CAS: 89976-12-5) is an organic compound featuring a benzene ring with three fluorine atoms, a nitro group at the 5-position, and a methyl group at the 2-position. It is typically a colorless solid with high chemical stability and exhibits strong electron-withdrawing properties due to the nitro and trifluoromethyl groups. This compound is widely used in synthetic chemistry for its reactivity and functional group versatility.

About

CAS No 89976-12-5
English Name 2-Methyl-5-nitrobenzotrifluoride
Molecular Formula C8H6F3NO2
Molecular Weight 205.13 g/mol
SMILES CC1=C(C=C(C=C1)[N+](=O)[O-])C(F)(F)F
InChIKey SVQCVQCIZWSPPX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-5-nitrobenzotrifluoride (CAS: 89976-12-5)?

2-Methyl-5-nitrobenzotrifluoride (CAS: 89976-12-5) is primarily used in pharmaceuticals as a key int...

Compound Q&A

Is 2-Methyl-5-nitrobenzotrifluoride (CAS: 89976-12-5) safe?

2-Methyl-5-nitrobenzotrifluoride (CAS: 89976-12-5) requires careful handling due to its potential to...

Compound Q&A

How should 2-Methyl-5-nitrobenzotrifluoride (CAS: 89976-12-5) be stored?

2-Methyl-5-nitrobenzotrifluoride (CAS: 89976-12-5) should be stored in a cool, dry place (ideally 2-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...