Compound Q&A

What are the main uses of Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate (CAS: 584-42-9)?

Answer

Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate
Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate (CAS: 584-42-9) is primarily used in pharmaceutical research as a building block for drug development. It also finds applications in organic chemistry for synthesizing complex molecules and in industrial processes involving dye and pigment production. Its unique structure makes it valuable in chemical research and development.

About

CAS No 584-42-9
English Name Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate
Molecular Formula C13H8N3NaO5
Molecular Weight 309.21 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])N=NC2=CC(=C(C=C2)[O-])C(=O)O.[Na+]
InChIKey ZHFPEICFUVWJIS-WPDLWGESSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate (CAS: 584-42-9)?

Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate (CAS: 584-42-9) is an organic sodium salt c...

Compound Q&A

Is Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate (CAS: 584-42-9) safe?

Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate (CAS: 584-42-9) is generally considered saf...

Compound Q&A

How should Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate (CAS: 584-42-9) be stored?

Sodium 2-hydroxy-5-[(E)-(3-nitrophenyl)diazenyl]benzoate (CAS: 584-42-9) should be stored in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...