Compound Q&A

What is Butane-1,4-diyl bis(2-methylacrylate) (CAS: 2082-81-7)?

Answer

Butane-1,4-diyl bis(2-methylacrylate)
Butane-1,4-diyl bis(2-methylacrylate) is a synthetic organic compound with the chemical formula C10H16O4. It is a diacrylate derivative composed of two 2-methylacrylate groups connected by a butane-1,4-diyl linker. This compound is known for its stability and reactivity, making it a useful material in polymer chemistry and material science applications.

About

CAS No 2082-81-7
English Name Butane-1,4-diyl bis(2-methylacrylate)
Molecular Formula C12H18O4
Molecular Weight 226.27 g/mol
SMILES CC(C(OCCCCOC(C(C)=C)=O)=O)=C
InChIKey XOJWAAUYNWGQAU-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Butane-1,4-diyl bis(2-methylacrylate) (CAS: 2082-81-7)?

Butane-1,4-diyl bis(2-methylacrylate) is commonly used in the production of polymeric materials, inc...

Compound Q&A

Is Butane-1,4-diyl bis(2-methylacrylate) (CAS: 2082-81-7) safe?

Butane-1,4-diyl bis(2-methylacrylate) is generally considered safe when handled properly. However, i...

Compound Q&A

How should Butane-1,4-diyl bis(2-methylacrylate) (CAS: 2082-81-7) be stored?

Butane-1,4-diyl bis(2-methylacrylate) should be stored in a cool, dry, and well-ventilated area, awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...