Compound Q&A

What is (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid (CAS: 333432-28-3)?

Answer

(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid
(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid is an organic compound with the CAS number 333432-28-3. It has the chemical formula C16H16BNO2 and is characterized by its fluorene ring structure with two methyl groups and a boronic acid functional group. This compound is known for its stability and is commonly used in organic synthesis due to its reactivity and compatibility with various chemical reactions.

About

English Name (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid
Molecular Formula C15H15BO2
Molecular Weight 238.1 g/mol
SMILES B(C1=CC2=C(C=C1)C3=CC=CC=C3C2(C)C)(O)O
InChIKey DMDPAJOXRYGXCB-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid (CAS: 333432-28-3)?

(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid (CAS: 333432-28-3) is widely used in pharmaceutical resea...

Compound Q&A

Is (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid (CAS: 333432-28-3) safe?

(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid (CAS: 333432-28-3) is generally considered safe when hand...

Compound Q&A

How should (9,9-Dimethyl-9H-fluoren-2-yl)boronic acid (CAS: 333432-28-3) be stored?

(9,9-Dimethyl-9H-fluoren-2-yl)boronic acid (CAS: 333432-28-3) should be stored in a cool, dry place ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...