Compound Q&A

What is 2-Methyl-2-propanyl (2S)-4-oxo-2-(1,3-thiazolidin-3-ylcarbonyl)-1-pyrrolidinecarboxylate (CAS: 401564-36-1)?

Answer

2-Methyl-2-propanyl (2S)-4-oxo-2-(1,3-thiazolidin-3-ylcarbonyl)-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl (2S)-4-oxo-2-(1,3-thiazolidin-3-ylcarbonyl)-1-pyrrolidinecarboxylate (CAS: 401564-36-1) is a complex organic compound containing a pyrrolidine ring and a thiazolidine moiety. It is characterized by its molecular structure, which includes a carbonyl group and an ester linkage. This compound is known for its potential applications in pharmaceutical and biochemical research due to its functional group diversity and reactivity.

About

English Name 2-Methyl-2-propanyl (2S)-4-oxo-2-(1,3-thiazolidin-3-ylcarbonyl)-1-pyrrolidinecarboxylate
Molecular Formula C13H20N2O4S
Molecular Weight 300.38 g/mol
SMILES O=C(N1[C@H](C(N2CSCC2)=O)CC(C1)=O)OC(C)(C)C
InChIKey ULXKZRPRLJGLDM-JTQLQIEISA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl (2S)-4-oxo-2-(1,3-thiazolidin-3-ylcarbonyl)-1-pyrrolidinecarboxylate (CAS: 401564-36-1)?

This compound is primarily used in pharmaceutical research for the development of drugs targeting ne...

Compound Q&A

Is 2-Methyl-2-propanyl (2S)-4-oxo-2-(1,3-thiazolidin-3-ylcarbonyl)-1-pyrrolidinecarboxylate (CAS: 401564-36-1) safe?

The safety of 2-Methyl-2-propanyl (2S)-4-oxo-2-(1,3-thiazolidin-3-ylcarbonyl)-1-pyrrolidinecarboxyla...

Compound Q&A

How should 2-Methyl-2-propanyl (2S)-4-oxo-2-(1,3-thiazolidin-3-ylcarbonyl)-1-pyrrolidinecarboxylate (CAS: 401564-36-1) be stored?

This compound should be stored in a cool, dry, and dark place to maintain its stability. It is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...