Compound Q&A

What is 2-Hydroxy-3,5-diiodobenzoic acid (CAS: 133-91-5)?

Answer

2-Hydroxy-3,5-diiodobenzoic acid
2-Hydroxy-3,5-diiodobenzoic acid (CAS: 133-91-5) is an organic compound with the chemical formula C7H6I2O3. It is a derivative of benzoic acid, featuring hydroxyl and two iodine atoms attached to the benzene ring. This compound is known for its strong acidic properties and is often used in various chemical applications due to its reactivity and functional groups.

About

CAS No 133-91-5
English Name 2-Hydroxy-3,5-diiodobenzoic acid
Molecular Formula C7H4I2O3
Molecular Weight 389.91 g/mol
SMILES C1=C(C=C(C(=C1C(=O)O)O)I)I
InChIKey DHZVWQPHNWDCFS-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 2-Hydroxy-3,5-diiodobenzoic acid (CAS: 133-91-5)?

2-Hydroxy-3,5-diiodobenzoic acid (CAS: 133-91-5) is primarily used in pharmaceutical research as a b...

Compound Q&A

Is 2-Hydroxy-3,5-diiodobenzoic acid (CAS: 133-91-5) safe?

2-Hydroxy-3,5-diiodobenzoic acid (CAS: 133-91-5) should be handled with care. It is considered toxic...

Compound Q&A

How should 2-Hydroxy-3,5-diiodobenzoic acid (CAS: 133-91-5) be stored?

2-Hydroxy-3,5-diiodobenzoic acid (CAS: 133-91-5) should be stored in a cool, dry, and dark place, aw...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...