Compound Q&A

What is (3beta,5alpha,25R)-Spirostan-3-ol (CAS: 77-60-1)?

Answer

(3beta,5alpha,25R)-Spirostan-3-ol
(3beta,5alpha,25R)-Spirostan-3-ol, with the CAS number 77-60-1, is a naturally occurring steroidal sapogenin. It is a white to pale yellow crystalline powder, typically found in plants such as Dioscorea species. This compound is known for its structural similarity to steroidal hormones and is used in various scientific and industrial applications due to its chemical properties and biological activity.

About

CAS No 77-60-1
English Name (3beta,5alpha,25R)-Spirostan-3-ol
Molecular Formula C27H44O3
Molecular Weight 416.65 g/mol
SMILES CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CCC6C5(CCC(C6)O)C)C)C)OC1
InChIKey GMBQZIIUCVWOCD-MFRNJXNGSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (3beta,5alpha,25R)-Spirostan-3-ol (CAS: 77-60-1)?

(3beta,5alpha,25R)-Spirostan-3-ol, CAS 77-60-1, is primarily used in pharmaceutical research for the...

Compound Q&A

Is (3beta,5alpha,25R)-Spirostan-3-ol (CAS: 77-60-1) safe?

(3beta,5alpha,25R)-Spirostan-3-ol, CAS 77-60-1, is generally considered safe when handled properly. ...

Compound Q&A

How should (3beta,5alpha,25R)-Spirostan-3-ol (CAS: 77-60-1) be stored?

(3beta,5alpha,25R)-Spirostan-3-ol, CAS 77-60-1, should be stored in a cool, dry, and dark place, pre...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...