Compound Q&A

How should 5-Quinolinecarboxylic acid (CAS: 7250-53-5) be stored?

Answer

5-Quinolinecarboxylic acid
5-Quinolinecarboxylic acid (CAS: 7250-53-5) should be stored in a cool, dry place, away from light, in a sealed container to prevent moisture exposure. Maintain storage temperatures between 2-8°C to ensure stability. Avoid contact with air and incompatible materials, and keep the container tightly closed to maintain chemical integrity and safety.

About

CAS No 7250-53-5
English Name 5-Quinolinecarboxylic acid
Molecular Formula C10H7NO2
Molecular Weight 173.17 g/mol
SMILES C1=CC(=C2C=CC=NC2=C1)C(=O)O
InChIKey RAYMXZBXQCGRGX-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 5-Quinolinecarboxylic acid (CAS: 7250-53-5)?

5-Quinolinecarboxylic acid (CAS: 7250-53-5) is a heterocyclic organic compound with the chemical for...

Compound Q&A

What are the main uses of 5-Quinolinecarboxylic acid (CAS: 7250-53-5)?

5-Quinolinecarboxylic acid (CAS: 7250-53-5) is widely used in the pharmaceutical industry as a precu...

Compound Q&A

Is 5-Quinolinecarboxylic acid (CAS: 7250-53-5) safe?

5-Quinolinecarboxylic acid (CAS: 7250-53-5) requires careful handling due to its potential toxicity....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...