Compound Q&A

What is 6-Bromo-3-nitro-4-quinolinol (CAS: 853908-50-6)?

Answer

6-Bromo-3-nitro-4-quinolinol
6-Bromo-3-nitro-4-quinolinol is an organic compound with the chemical formula C9H7BrNO2. It is a brominated and nitrated derivative of quinolinol, characterized by its aromatic ring structure and polar functional groups. This compound is typically used as an intermediate in chemical synthesis due to its reactivity and functional versatility.

About

English Name 6-Bromo-3-nitro-4-quinolinol
Molecular Formula C9H5BrN2O3
Molecular Weight 269.05 g/mol
SMILES Oc1c(cnc2ccc(Br)cc12)[N+](=O)[O-]
InChIKey AMKJVYOALDEARM-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of 6-Bromo-3-nitro-4-quinolinol (CAS: 853908-50-6)?

6-Bromo-3-nitro-4-quinolinol is primarily used in pharmaceutical research as a building block for th...

Compound Q&A

Is 6-Bromo-3-nitro-4-quinolinol (CAS: 853908-50-6) safe?

6-Bromo-3-nitro-4-quinolinol is considered hazardous due to its potential toxicity. It should be han...

Compound Q&A

How should 6-Bromo-3-nitro-4-quinolinol (CAS: 853908-50-6) be stored?

6-Bromo-3-nitro-4-quinolinol should be stored in a cool, dry, and well-ventilated area, away from li...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...