Compound Q&A

What are the main uses of 2,6-Dimethoxybenzoic acid (CAS: 1466-76-8)?

Answer

2,6-Dimethoxybenzoic acid
2,6-Dimethoxybenzoic acid (CAS: 1466-76-8) is primarily used in pharmaceuticals as a precursor for drug synthesis, particularly in the development of anti-inflammatory agents. It also serves as an intermediate in industrial applications, such as dye manufacturing and polymer production. In research, it is utilized for studying chemical reactivity and as a building block for complex organic molecules.

About

CAS No 1466-76-8
English Name 2,6-Dimethoxybenzoic acid
Molecular Formula C9H10O4
Molecular Weight 182.17 g/mol
SMILES COC1=C(C(=CC=C1)OC)C(=O)O
InChIKey MBIZFBDREVRUHY-UHFFFAOYSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is 2,6-Dimethoxybenzoic acid (CAS: 1466-76-8)?

2,6-Dimethoxybenzoic acid (CAS: 1466-76-8) is an organic compound with the chemical formula C8H10O4....

Compound Q&A

Is 2,6-Dimethoxybenzoic acid (CAS: 1466-76-8) safe?

2,6-Dimethoxybenzoic acid (CAS: 1466-76-8) is generally considered safe when handled properly. Howev...

Compound Q&A

How should 2,6-Dimethoxybenzoic acid (CAS: 1466-76-8) be stored?

2,6-Dimethoxybenzoic acid (CAS: 1466-76-8) should be stored in a sealed, airtight container at room ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...