Compound Q&A

What is O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine (CAS: 86123-95-7)?

Answer

O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine
O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine is a chemical compound with the CAS number 86123-95-7. It is an ester derivative of D-serine, characterized by the presence of a methyl group and a tert-butyl carbonyl oxygen group. This compound is typically used in research and pharmaceutical contexts due to its structural properties and potential biological activity.

About

CAS No 86123-95-7
English Name O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine
Molecular Formula C9H17NO5
Molecular Weight 219.237 g/mol
SMILES O=C(O)[C@@H](COC)NC(OC(C)(C)C)=O
InChIKey RFGMSGRWQUMJIR-ZCFIWIBFSA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine (CAS: 86123-95-7)?

O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine is primarily used in pharmaceutical researc...

Compound Q&A

Is O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine (CAS: 86123-95-7) safe?

O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine is generally considered safe when handled p...

Compound Q&A

How should O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine (CAS: 86123-95-7) be stored?

O-Methyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-serine should be stored in a cool, dry, and dark p...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...