Compound Q&A

What is Disodium 5-[(7-sulfonato-1-naphthyl)methyl]-2-naphthalenesulfonate (CAS: 36290-04-7)?

Answer

Disodium 5-[(7-sulfonato-1-naphthyl)methyl]-2-naphthalenesulfonate
Disodium 5-[(7-sulfonato-1-naphthyl)methyl]-2-naphthalenesulfonate is a sodium salt of a naphthalene sulfonate derivative. It has the chemical formula C16H10Na2O6S2 and is commonly used as a food additive. The compound is known for its ability to chelate metal ions and is characterized by its high water solubility and stability under normal conditions.

About

CAS No 36290-04-7
English Name Disodium 5-[(7-sulfonato-1-naphthyl)methyl]-2-naphthalenesulfonate
Molecular Formula C21H14Na2O6S2
Molecular Weight 261.25 g/mol
SMILES C=O.C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)O.[Na]
InChIKey QRQNUYIFDVVGQG-UHFFFAOYSA-L
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of Disodium 5-[(7-sulfonato-1-naphthyl)methyl]-2-naphthalenesulfonate (CAS: 36290-04-7)?

This compound is primarily used as a sequestrant in food products to bind and neutralize metal ions,...

Compound Q&A

Is Disodium 5-[(7-sulfonato-1-naphthyl)methyl]-2-naphthalenesulfonate (CAS: 36290-04-7) safe?

Disodium 5-[(7-sulfonato-1-naphthyl)methyl]-2-naphthalenesulfonate is generally considered safe when...

Compound Q&A

How should Disodium 5-[(7-sulfonato-1-naphthyl)methyl]-2-naphthalenesulfonate (CAS: 36290-04-7) be stored?

The compound should be stored in a cool, dry, and dark place, away from moisture and direct sunlight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...