Compound Q&A

What is (2S)-2-Benzylsuccinic acid (CAS: 3972-36-9)?

Answer

(2S)-2-Benzylsuccinic acid
(2S)-2-Benzylsuccinic acid (CAS: 3972-36-9) is a chiral organic compound with the chemical formula C10H12O4. It is a derivative of succinic acid, featuring a benzyl group attached to the second carbon. This compound is a white crystalline solid, soluble in water, and exhibits specific stereochemical properties, making it valuable in pharmaceutical and chemical synthesis applications.

About

CAS No 3972-36-9
English Name (2S)-2-Benzylsuccinic acid
Molecular Formula C11H12O4
Molecular Weight 208.21 g/mol
SMILES C1=CC=C(C=C1)CC(CC(=O)O)C(=O)O
InChIKey GTOFKXZQQDSVFH-VIFPVBQESA-N
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What are the main uses of (2S)-2-Benzylsuccinic acid (CAS: 3972-36-9)?

(2S)-2-Benzylsuccinic acid (CAS: 3972-36-9) is primarily used in pharmaceuticals as a chiral interme...

Compound Q&A

Is (2S)-2-Benzylsuccinic acid (CAS: 3972-36-9) safe?

(2S)-2-Benzylsuccinic acid (CAS: 3972-36-9) is generally considered safe when handled properly. Howe...

Compound Q&A

How should (2S)-2-Benzylsuccinic acid (CAS: 3972-36-9) be stored?

(2S)-2-Benzylsuccinic acid (CAS: 3972-36-9) should be stored in a cool, dry, and dark place, ideally...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...