Compound Q&A

How should Salcaprozate sodium (CAS: 203787-91-1) be stored?

Answer

Salcaprozate sodium
Salcaprozate sodium should be stored in a cool, dry place away from moisture and light. It is typically kept in airtight containers at a temperature between 15°C to 25°C. Avoid exposure to high humidity or direct sunlight to maintain stability and prevent degradation. Store in a secure location to prevent accidental ingestion or contamination.

About

English Name Salcaprozate sodium
Molecular Formula C15H20NNaO4
Molecular Weight 301.31 g/mol
SMILES C1=CC=C(C(=C1)C(=O)NCCCCCCCC(=O)[O-])O.[Na+]
InChIKey UOENJXXSKABLJL-UHFFFAOYSA-M
Last Updated: 2025-08-25 01:07

Related Q&A

Compound Q&A

What is Salcaprozate sodium (CAS: 203787-91-1)?

Salcaprozate sodium is a sodium salt of salcaprozate, a non-steroidal anti-inflammatory drug (NSAID)...

Compound Q&A

What are the main uses of Salcaprozate sodium (CAS: 203787-91-1)?

Salcaprozate sodium is primarily used in research settings to study inflammation and pain mechanisms...

Compound Q&A

Is Salcaprozate sodium (CAS: 203787-91-1) safe?

Salcaprozate sodium is generally considered safe when used as directed in research or pharmaceutical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...